C21H26O3 — CID 83951936
3-(4-butoxyphenyl)-2-(2,4-dimethylphenyl)propanoic acid (PubChem CID 83951936) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-2-(2,4-dimethylphenyl)propanoic acid.
| Compound Name | 3-(4-butoxyphenyl)-2-(2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 83951936 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-(4-butoxyphenyl)-2-(2,4-dimethylphenyl)propanoic acid |
| SMILES | CCCCOc1ccc(CC(C(=O)O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H26O3/c1-4-5-12-24-18-9-7-17(8-10-18)14-20(21(22)23)19-11-6-15(2)13-16(19)3/h6-11,13,20H,4-5,12,14H2,1-3H3,(H,22,23) |
| InChIKey | IQNDOBMITHVKAV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|