C21H20O4S — CID 22687888
3-[3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 22687888) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is 3-[3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22687888 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 3-[3-(2-phenoxyethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)C(Cc1cccc(OCCOc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C21H20O4S/c22-21(23)19(20-10-5-13-26-20)15-16-6-4-9-18(14-16)25-12-11-24-17-7-2-1-3-8-17/h1-10,13-14,19H,11-12,15H2,(H,22,23) |
| InChIKey | QFECSPBUDNGHSY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|