C20H25ClO4S — CID 22681743
3-(3-chloro-5-ethoxy-4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid (PubChem CID 22681743) has the molecular formula C20H25ClO4S and a molecular weight of 396.94 g/mol. Its IUPAC name is 3-(3-chloro-5-ethoxy-4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-(3-chloro-5-ethoxy-4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 22681743 |
| Molecular Formula | C20H25ClO4S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-(3-chloro-5-ethoxy-4-pentoxyphenyl)-2-thiophen-2-ylpropanoic acid |
| SMILES | CCCCCOc1c(Cl)cc(CC(C(=O)O)c2cccs2)cc1OCC |
| InChI | InChI=1S/C20H25ClO4S/c1-3-5-6-9-25-19-16(21)12-14(13-17(19)24-4-2)11-15(20(22)23)18-8-7-10-26-18/h7-8,10,12-13,15H,3-6,9,11H2,1-2H3,(H,22,23) |
| InChIKey | JXZZACFPKBQZEC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|