C16H24O3 — CID 100531315
(2R)-2-butoxy-3-(4-propan-2-ylphenyl)propanoic acid (PubChem CID 100531315) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2R)-2-butoxy-3-(4-propan-2-ylphenyl)propanoic acid.
| Compound Name | (2R)-2-butoxy-3-(4-propan-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100531315 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2R)-2-butoxy-3-(4-propan-2-ylphenyl)propanoic acid |
| SMILES | CCCCO[C@H](Cc1ccc(C(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-4-5-10-19-15(16(17)18)11-13-6-8-14(9-7-13)12(2)3/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,17,18)/t15-/m1/s1 |
| InChIKey | SOPWQYHJKJJGKJ-OAHLLOKOSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|