C15H11Cl3O3 — CID 100540005
(2S)-2-(2-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoic acid (PubChem CID 100540005) has the molecular formula C15H11Cl3O3 and a molecular weight of 345.61 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoic acid.
| Compound Name | (2S)-2-(2-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 100540005 |
| Molecular Formula | C15H11Cl3O3 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | (2S)-2-(2-chlorophenoxy)-3-(3,4-dichlorophenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(Cl)c(Cl)c1)Oc1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl3O3/c16-10-6-5-9(7-12(10)18)8-14(15(19)20)21-13-4-2-1-3-11(13)17/h1-7,14H,8H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | SYAOOQTUELMQFC-AWEZNQCLSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |