C19H22O3 — CID 100528037
(2S)-2-(3,4-dimethylphenoxy)-3-(2,6-dimethylphenyl)propanoic acid (PubChem CID 100528037) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenoxy)-3-(2,6-dimethylphenyl)propanoic acid.
| Compound Name | (2S)-2-(3,4-dimethylphenoxy)-3-(2,6-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100528037 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenoxy)-3-(2,6-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(O[C@@H](Cc2c(C)cccc2C)C(=O)O)cc1C |
| InChI | InChI=1S/C19H22O3/c1-12-8-9-16(10-15(12)4)22-18(19(20)21)11-17-13(2)6-5-7-14(17)3/h5-10,18H,11H2,1-4H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | UQCJMLYKUSFBGR-SFHVURJKSA-N |
| XLogP | 3.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |