(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid

C21H20O3 — CID 100531748

IUPAC(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid
SMILESCc1ccc(O[C@H](Cc2cccc3ccccc23)C(=O)O)cc1C
InChIInChI=1S/C21H20O3/c1-14-10-11-18(12-15(14)2)24-20(21(22)23)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-12,20H,13H2,1-2H3,(H,22,23)/t20-/m1/s1
InChIKeyJCHQPFLTYOCAPW-HXUWFJFHSA-N
MW320.39 g/mol
LogP4.53
Rot. Bonds5

About (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid

(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid (PubChem CID 100531748) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid
PubChem CID100531748
Molecular FormulaC21H20O3
Molecular Weight320.39 g/mol
Exact Mass320.14
IUPAC Name(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid
SMILESCc1ccc(O[C@H](Cc2cccc3ccccc23)C(=O)O)cc1C
InChIInChI=1S/C21H20O3/c1-14-10-11-18(12-15(14)2)24-20(21(22)23)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-12,20H,13H2,1-2H3,(H,22,23)/t20-/m1/s1
InChIKeyJCHQPFLTYOCAPW-HXUWFJFHSA-N
XLogP4.53
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.39
LogP ≤ 54.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid?
The IUPAC name of (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid (CID 100531748) is (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid.
What is the SMILES notation for (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid?
The canonical SMILES for (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid is Cc1ccc(O[C@H](Cc2cccc3ccccc23)C(=O)O)cc1C.
What is the InChIKey of (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid?
The InChIKey is JCHQPFLTYOCAPW-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H20O3/c1-14-10-11-18(12-15(14)2)24-20(21(22)23)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-12,20H,13H2,1-2H3,(H,22,23)/t20-/m1/s1.
What are the key properties of (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid?
(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid has a molecular weight of 320.39 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid is sourced from PubChem (CID 100531748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).