C21H20O3 — CID 100531748
(2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid (PubChem CID 100531748) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid.
| Compound Name | (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 100531748 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2R)-2-(3,4-dimethylphenoxy)-3-naphthalen-1-ylpropanoic acid |
| SMILES | Cc1ccc(O[C@H](Cc2cccc3ccccc23)C(=O)O)cc1C |
| InChI | InChI=1S/C21H20O3/c1-14-10-11-18(12-15(14)2)24-20(21(22)23)13-17-8-5-7-16-6-3-4-9-19(16)17/h3-12,20H,13H2,1-2H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | JCHQPFLTYOCAPW-HXUWFJFHSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |