2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid

C11H14O4 — CID 83223513

IUPAC2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid
SMILESCc1ccccc1C(OCCO)C(=O)O
InChIInChI=1S/C11H14O4/c1-8-4-2-3-5-9(8)10(11(13)14)15-7-6-12/h2-5,10,12H,6-7H2,1H3,(H,13,14)
InChIKeyDTCKQUWDKPFWLU-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.13
Rot. Bonds5

About 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid

2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid (PubChem CID 83223513) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid.

Molecular Properties

Compound Name2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid
PubChem CID83223513
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid
SMILESCc1ccccc1C(OCCO)C(=O)O
InChIInChI=1S/C11H14O4/c1-8-4-2-3-5-9(8)10(11(13)14)15-7-6-12/h2-5,10,12H,6-7H2,1H3,(H,13,14)
InChIKeyDTCKQUWDKPFWLU-UHFFFAOYSA-N
XLogP1.13
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2-ethoxyphenyl)-2-(2-hydroxyethoxy)acetic acid
CID 83224823
2-(2-hydroxyethoxy)-2-(4-methylphenyl)acetic acid
CID 83224145
2-(difluoromethoxy)-2-(2-methylphenyl)acetic acid
CID 84723828
2-(2,6-dimethylphenyl)-2-(3-hydroxypropoxy)acetic acid
CID 83224254
2-[(2-ethylphenyl)-(2-methylphenyl)methoxy]ethanol
CID 12025454
2-(3-bromo-4-methylphenyl)-2-(2-hydroxyethoxy)acetic acid
CID 103377667
2-(3-hydroxypropoxy)-2-(2,4,5-trimethylphenyl)acetic acid
CID 114078427
2-methoxy-2-(2-methylphenyl)-1-phenylethanone
CID 71321553
3-ethoxy-2-(2-methylphenyl)-3-oxopropanoic acid
CID 103974778
2-(2,3-dichlorophenyl)-2-propoxyacetic acid
CID 83224713
2-chloro-2-(2-methylphenyl)acetic acid
CID 23338325
2-[hydroxy-(2-methylphenyl)methyl]-3-methylbutanoic acid
CID 62396840

Frequently Asked Questions

What is the IUPAC name of 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid?
The IUPAC name of 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid (CID 83223513) is 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid.
What is the SMILES notation for 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid?
The canonical SMILES for 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid is Cc1ccccc1C(OCCO)C(=O)O.
What is the InChIKey of 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid?
The InChIKey is DTCKQUWDKPFWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-8-4-2-3-5-9(8)10(11(13)14)15-7-6-12/h2-5,10,12H,6-7H2,1H3,(H,13,14).
What are the key properties of 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid?
2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)-2-(2-methylphenyl)acetic acid is sourced from PubChem (CID 83223513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).