C12H17FO3 — CID 112509946
1-(3-fluoro-4-methoxyphenyl)pentane-1,5-diol (PubChem CID 112509946) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)pentane-1,5-diol.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 112509946 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)pentane-1,5-diol |
| SMILES | COc1ccc(C(O)CCCCO)cc1F |
| InChI | InChI=1S/C12H17FO3/c1-16-12-6-5-9(8-10(12)13)11(15)4-2-3-7-14/h5-6,8,11,14-15H,2-4,7H2,1H3 |
| InChIKey | AJJXAHZKSQYWFG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|