C12H17FO3 — CID 62797147
1-(3-fluoro-4-methoxyphenyl)-2-propoxyethanol (PubChem CID 62797147) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-2-propoxyethanol.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-2-propoxyethanol |
|---|---|
| PubChem CID | 62797147 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-2-propoxyethanol |
| SMILES | CCCOCC(O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C12H17FO3/c1-3-6-16-8-11(14)9-4-5-12(15-2)10(13)7-9/h4-5,7,11,14H,3,6,8H2,1-2H3 |
| InChIKey | WMOHPVJHHBLWNN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|