C17H31NO6 — CID 87295318
(2S)-2-[[[(1S)-1-acetyloxy-2-methylpropoxy]carbonylamino]methyl]-5-ethylheptanoic acid (PubChem CID 87295318) has the molecular formula C17H31NO6 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S)-2-[[[(1S)-1-acetyloxy-2-methylpropoxy]carbonylamino]methyl]-5-ethylheptanoic acid.
| Compound Name | (2S)-2-[[[(1S)-1-acetyloxy-2-methylpropoxy]carbonylamino]methyl]-5-ethylheptanoic acid |
|---|---|
| PubChem CID | 87295318 |
| Molecular Formula | C17H31NO6 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (2S)-2-[[[(1S)-1-acetyloxy-2-methylpropoxy]carbonylamino]methyl]-5-ethylheptanoic acid |
| SMILES | CCC(CC)CC[C@@H](CNC(=O)O[C@H](OC(C)=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C17H31NO6/c1-6-13(7-2)8-9-14(15(20)21)10-18-17(22)24-16(11(3)4)23-12(5)19/h11,13-14,16H,6-10H2,1-5H3,(H,18,22)(H,20,21)/t14-,16-/m0/s1 |
| InChIKey | NFLXXCYXMQVJSZ-HOCLYGCPSA-N |
| XLogP | 3.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|