C18H33NO6 — CID 87294935
(2S,4S)-4-ethyl-6-methyl-2-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]heptanoic acid (PubChem CID 87294935) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (2S,4S)-4-ethyl-6-methyl-2-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]heptanoic acid.
| Compound Name | (2S,4S)-4-ethyl-6-methyl-2-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]heptanoic acid |
|---|---|
| PubChem CID | 87294935 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (2S,4S)-4-ethyl-6-methyl-2-[[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]methyl]heptanoic acid |
| SMILES | CC[C@@H](CC(C)C)C[C@@H](CNC(=O)O[C@@H](C)OC(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H33NO6/c1-7-14(8-11(2)3)9-15(16(20)21)10-19-18(23)25-13(6)24-17(22)12(4)5/h11-15H,7-10H2,1-6H3,(H,19,23)(H,20,21)/t13-,14-,15-/m0/s1 |
| InChIKey | BPYQKTOFBFYNLD-KKUMJFAQSA-N |
| XLogP | 3.42 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|