C15H27NO6S — CID 87295298
(2S)-3-[[(1R)-1-acetyloxy-2-methylpropoxy]carbonylamino]-2-pentan-3-ylsulfanylpropanoic acid (PubChem CID 87295298) has the molecular formula C15H27NO6S and a molecular weight of 349.45 g/mol. Its IUPAC name is (2S)-3-[[(1R)-1-acetyloxy-2-methylpropoxy]carbonylamino]-2-pentan-3-ylsulfanylpropanoic acid.
| Compound Name | (2S)-3-[[(1R)-1-acetyloxy-2-methylpropoxy]carbonylamino]-2-pentan-3-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 87295298 |
| Molecular Formula | C15H27NO6S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2S)-3-[[(1R)-1-acetyloxy-2-methylpropoxy]carbonylamino]-2-pentan-3-ylsulfanylpropanoic acid |
| SMILES | CCC(CC)S[C@@H](CNC(=O)O[C@@H](OC(C)=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C15H27NO6S/c1-6-11(7-2)23-12(13(18)19)8-16-15(20)22-14(9(3)4)21-10(5)17/h9,11-12,14H,6-8H2,1-5H3,(H,16,20)(H,18,19)/t12-,14+/m0/s1 |
| InChIKey | LMXLJIWBLFIRPM-GXTWGEPZSA-N |
| XLogP | 2.63 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|