C12H21NO6S — CID 87295419
(2S)-3-[[(1S)-1-propanoyloxyethoxy]carbonylamino]-2-propan-2-ylsulfanylpropanoic acid (PubChem CID 87295419) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is (2S)-3-[[(1S)-1-propanoyloxyethoxy]carbonylamino]-2-propan-2-ylsulfanylpropanoic acid.
| Compound Name | (2S)-3-[[(1S)-1-propanoyloxyethoxy]carbonylamino]-2-propan-2-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 87295419 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2S)-3-[[(1S)-1-propanoyloxyethoxy]carbonylamino]-2-propan-2-ylsulfanylpropanoic acid |
| SMILES | CCC(=O)O[C@H](C)OC(=O)NCC(SC(C)C)C(=O)O |
| InChI | InChI=1S/C12H21NO6S/c1-5-10(14)18-8(4)19-12(17)13-6-9(11(15)16)20-7(2)3/h7-9H,5-6H2,1-4H3,(H,13,17)(H,15,16)/t8-,9?/m0/s1 |
| InChIKey | ADANWBOZLVYILT-IENPIDJESA-N |
| XLogP | 1.61 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|