C19H35NO6 — CID 87295026
(4S)-8-methyl-4-[3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propyl]nonanoic acid (PubChem CID 87295026) has the molecular formula C19H35NO6 and a molecular weight of 373.49 g/mol. Its IUPAC name is (4S)-8-methyl-4-[3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propyl]nonanoic acid.
| Compound Name | (4S)-8-methyl-4-[3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propyl]nonanoic acid |
|---|---|
| PubChem CID | 87295026 |
| Molecular Formula | C19H35NO6 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | (4S)-8-methyl-4-[3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propyl]nonanoic acid |
| SMILES | CCC(=O)O[C@@H](C)OC(=O)NCCCC(CCCC(C)C)CCC(=O)O |
| InChI | InChI=1S/C19H35NO6/c1-5-18(23)25-15(4)26-19(24)20-13-7-10-16(11-12-17(21)22)9-6-8-14(2)3/h14-16H,5-13H2,1-4H3,(H,20,24)(H,21,22)/t15-,16?/m1/s1 |
| InChIKey | PRZMPQLHRNWGIC-AAFJCEBUSA-N |
| XLogP | 4.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|