C18H33NO6 — CID 87295348
(4S)-4-[3-[[(1R)-1-acetyloxyethoxy]carbonylamino]propyl]-8-methylnonanoic acid (PubChem CID 87295348) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (4S)-4-[3-[[(1R)-1-acetyloxyethoxy]carbonylamino]propyl]-8-methylnonanoic acid.
| Compound Name | (4S)-4-[3-[[(1R)-1-acetyloxyethoxy]carbonylamino]propyl]-8-methylnonanoic acid |
|---|---|
| PubChem CID | 87295348 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (4S)-4-[3-[[(1R)-1-acetyloxyethoxy]carbonylamino]propyl]-8-methylnonanoic acid |
| SMILES | CC(=O)O[C@@H](C)OC(=O)NCCC[C@H](CCCC(C)C)CCC(=O)O |
| InChI | InChI=1S/C18H33NO6/c1-13(2)7-5-8-16(10-11-17(21)22)9-6-12-19-18(23)25-15(4)24-14(3)20/h13,15-16H,5-12H2,1-4H3,(H,19,23)(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | LKJAGCNSOAKKOY-CVEARBPZSA-N |
| XLogP | 3.71 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|