C15H29NO4 — CID 135192611
6-(2,5-dimethylhexan-2-yloxycarbonylamino)hexanoic acid (PubChem CID 135192611) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is 6-(2,5-dimethylhexan-2-yloxycarbonylamino)hexanoic acid.
| Compound Name | 6-(2,5-dimethylhexan-2-yloxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 135192611 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 6-(2,5-dimethylhexan-2-yloxycarbonylamino)hexanoic acid |
| SMILES | CC(C)CCC(C)(C)OC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C15H29NO4/c1-12(2)9-10-15(3,4)20-14(19)16-11-7-5-6-8-13(17)18/h12H,5-11H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | NJRAESHTMFIQLV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|