About 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid
7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid (PubChem CID 172838661) has the molecular formula C27H57NO2
and a molecular weight of 427.76 g/mol. Its IUPAC name is 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid.
Molecular Properties
| Compound Name | 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid |
| PubChem CID | 172838661 |
| Molecular Formula | C27H57NO2 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.44 |
| IUPAC Name | 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid |
| SMILES | CC(C)CCCCCC(=O)O.CC(C)CCCCCCNCCCCCCC(C)C |
| InChI | InChI=1S/C18H39N.C9H18O2/c1-17(2)13-9-5-7-11-15-19-16-12-8-6-10-14-18(3)4;1-8(2)6-4-3-5-7-9(10)11/h17-19H,5-16H2,1-4H3;8H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | WMOLRLWCANIDKB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid?
The IUPAC name of 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid (CID 172838661) is 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid.
What is the SMILES notation for 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid?
The canonical SMILES for 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid is CC(C)CCCCCC(=O)O.CC(C)CCCCCCNCCCCCCC(C)C.
What is the InChIKey of 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid?
The InChIKey is WMOLRLWCANIDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.C9H18O2/c1-17(2)13-9-5-7-11-15-19-16-12-8-6-10-14-18(3)4;1-8(2)6-4-3-5-7-9(10)11/h17-19H,5-16H2,1-4H3;8H,3-7H2,1-2H3,(H,10,11).
What are the key properties of 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid?
7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid has a molecular weight of 427.76 g/mol, XLogP of 8.47, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-N-(7-methyloctyl)octan-1-amine;7-methyloctanoic acid is sourced from PubChem (CID 172838661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).