About 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine
16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine (PubChem CID 175713444) has the molecular formula C24H51NO2
and a molecular weight of 385.68 g/mol. Its IUPAC name is 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine |
| PubChem CID | 175713444 |
| Molecular Formula | C24H51NO2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.39 |
| IUPAC Name | 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.CC(C)NC(C)C |
| InChI | InChI=1S/C18H36O2.C6H15N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-5(2)7-6(3)4/h17H,3-16H2,1-2H3,(H,19,20);5-7H,1-4H3 |
| InChIKey | KHPOGWWFALEBNU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine?
The IUPAC name of 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine (CID 175713444) is 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine?
The canonical SMILES for 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine is CC(C)CCCCCCCCCCCCCCC(=O)O.CC(C)NC(C)C.
What is the InChIKey of 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine?
The InChIKey is KHPOGWWFALEBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C6H15N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-5(2)7-6(3)4/h17H,3-16H2,1-2H3,(H,19,20);5-7H,1-4H3.
What are the key properties of 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine?
16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine has a molecular weight of 385.68 g/mol, XLogP of 7.58, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-methylheptadecanoic acid;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 175713444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).