C15H27NO6 — CID 53234512
(3R,4R,5R)-3-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-4,5-dimethylheptanoic acid (PubChem CID 53234512) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is (3R,4R,5R)-3-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-4,5-dimethylheptanoic acid.
| Compound Name | (3R,4R,5R)-3-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-4,5-dimethylheptanoic acid |
|---|---|
| PubChem CID | 53234512 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (3R,4R,5R)-3-[[[(1R)-1-acetyloxyethoxy]carbonylamino]methyl]-4,5-dimethylheptanoic acid |
| SMILES | CC[C@@H](C)[C@@H](C)C(CNC(=O)O[C@H](C)OC(C)=O)CC(=O)O |
| InChI | InChI=1S/C15H27NO6/c1-6-9(2)10(3)13(7-14(18)19)8-16-15(20)22-12(5)21-11(4)17/h9-10,12-13H,6-8H2,1-5H3,(H,16,20)(H,18,19)/t9-,10-,12-,13?/m1/s1 |
| InChIKey | GIIASTYZKYCHIL-RSRJGPJESA-N |
| XLogP | 2.39 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|