C13H23NO6 — CID 87296210
(3S,5R)-3-[[(1R)-1-acetyloxyethoxy]carbonylamino]-5-methylheptanoic acid (PubChem CID 87296210) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3S,5R)-3-[[(1R)-1-acetyloxyethoxy]carbonylamino]-5-methylheptanoic acid.
| Compound Name | (3S,5R)-3-[[(1R)-1-acetyloxyethoxy]carbonylamino]-5-methylheptanoic acid |
|---|---|
| PubChem CID | 87296210 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3S,5R)-3-[[(1R)-1-acetyloxyethoxy]carbonylamino]-5-methylheptanoic acid |
| SMILES | CC[C@@H](C)C[C@@H](CC(=O)O)NC(=O)O[C@H](C)OC(C)=O |
| InChI | InChI=1S/C13H23NO6/c1-5-8(2)6-11(7-12(16)17)14-13(18)20-10(4)19-9(3)15/h8,10-11H,5-7H2,1-4H3,(H,14,18)(H,16,17)/t8-,10-,11+/m1/s1 |
| InChIKey | GTULMNHXVPEBMQ-IEBDPFPHSA-N |
| XLogP | 1.90 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|