C15H18ClNO6S — CID 67172611
(2S)-2-(3-chlorophenyl)sulfanyl-3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propanoic acid (PubChem CID 67172611) has the molecular formula C15H18ClNO6S and a molecular weight of 375.83 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)sulfanyl-3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propanoic acid.
| Compound Name | (2S)-2-(3-chlorophenyl)sulfanyl-3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67172611 |
| Molecular Formula | C15H18ClNO6S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)sulfanyl-3-[[(1R)-1-propanoyloxyethoxy]carbonylamino]propanoic acid |
| SMILES | CCC(=O)O[C@@H](C)OC(=O)NC[C@H](Sc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H18ClNO6S/c1-3-13(18)22-9(2)23-15(21)17-8-12(14(19)20)24-11-6-4-5-10(16)7-11/h4-7,9,12H,3,8H2,1-2H3,(H,17,21)(H,19,20)/t9-,12+/m1/s1 |
| InChIKey | GZPFLECMUWWJIJ-SKDRFNHKSA-N |
| XLogP | 2.91 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|