About 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate
1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate (PubChem CID 142400282) has the molecular formula C16H25ClO2
and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate.
Molecular Properties
| Compound Name | 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate |
| PubChem CID | 142400282 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate |
| SMILES | CCC(=O)OC(C)CC(C)C.Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H18O2.C7H7Cl/c1-5-9(10)11-8(4)6-7(2)3;1-6-3-2-4-7(8)5-6/h7-8H,5-6H2,1-4H3;2-5H,1H3 |
| InChIKey | RIGMRLHOUMJUGR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate?
The IUPAC name of 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate (CID 142400282) is 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate.
What is the SMILES notation for 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate?
The canonical SMILES for 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate is CCC(=O)OC(C)CC(C)C.Cc1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate?
The InChIKey is RIGMRLHOUMJUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2.C7H7Cl/c1-5-9(10)11-8(4)6-7(2)3;1-6-3-2-4-7(8)5-6/h7-8H,5-6H2,1-4H3;2-5H,1H3.
What are the key properties of 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate?
1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate has a molecular weight of 284.83 g/mol, XLogP of 5.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-methylbenzene;4-methylpentan-2-yl propanoate is sourced from PubChem (CID 142400282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).