C16H23ClO2 — CID 145114802
[1-(3-chlorophenyl)-4,4-dimethylpentan-2-yl] propanoate (PubChem CID 145114802) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-4,4-dimethylpentan-2-yl] propanoate.
| Compound Name | [1-(3-chlorophenyl)-4,4-dimethylpentan-2-yl] propanoate |
|---|---|
| PubChem CID | 145114802 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [1-(3-chlorophenyl)-4,4-dimethylpentan-2-yl] propanoate |
| SMILES | CCC(=O)OC(Cc1cccc(Cl)c1)CC(C)(C)C |
| InChI | InChI=1S/C16H23ClO2/c1-5-15(18)19-14(11-16(2,3)4)10-12-7-6-8-13(17)9-12/h6-9,14H,5,10-11H2,1-4H3 |
| InChIKey | JQHVSNVUBFDJHS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |