C14H19ClO3 — CID 114495142
2-[(3-chlorophenyl)methyl]-4-hydroxy-4-methylhexanoic acid (PubChem CID 114495142) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-4-hydroxy-4-methylhexanoic acid.
| Compound Name | 2-[(3-chlorophenyl)methyl]-4-hydroxy-4-methylhexanoic acid |
|---|---|
| PubChem CID | 114495142 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-4-hydroxy-4-methylhexanoic acid |
| SMILES | CCC(C)(O)CC(Cc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H19ClO3/c1-3-14(2,18)9-11(13(16)17)7-10-5-4-6-12(15)8-10/h4-6,8,11,18H,3,7,9H2,1-2H3,(H,16,17) |
| InChIKey | GWVIRJKVRQJETD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |