C8H15NO5 — CID 106108243
2-methoxy-3-(propan-2-yloxycarbonylamino)propanoic acid (PubChem CID 106108243) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-methoxy-3-(propan-2-yloxycarbonylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(propan-2-yloxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 106108243 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-methoxy-3-(propan-2-yloxycarbonylamino)propanoic acid |
| SMILES | COC(CNC(=O)OC(C)C)C(=O)O |
| InChI | InChI=1S/C8H15NO5/c1-5(2)14-8(12)9-4-6(13-3)7(10)11/h5-6H,4H2,1-3H3,(H,9,12)(H,10,11) |
| InChIKey | BPXBFJBZRAPIES-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |