C9H19NO2S — CID 116656155
propan-2-yl N-(2-methyl-3-methylsulfanylpropyl)carbamate (PubChem CID 116656155) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is propan-2-yl N-(2-methyl-3-methylsulfanylpropyl)carbamate.
| Compound Name | propan-2-yl N-(2-methyl-3-methylsulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 116656155 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | propan-2-yl N-(2-methyl-3-methylsulfanylpropyl)carbamate |
| SMILES | CSCC(C)CNC(=O)OC(C)C |
| InChI | InChI=1S/C9H19NO2S/c1-7(2)12-9(11)10-5-8(3)6-13-4/h7-8H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | PTFZKAROZDKUGJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |