C8H14N2OS — CID 63959776
2-cyano-N-(2-methyl-3-methylsulfanylpropyl)acetamide (PubChem CID 63959776) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-cyano-N-(2-methyl-3-methylsulfanylpropyl)acetamide.
| Compound Name | 2-cyano-N-(2-methyl-3-methylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 63959776 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-cyano-N-(2-methyl-3-methylsulfanylpropyl)acetamide |
| SMILES | CSCC(C)CNC(=O)CC#N |
| InChI | InChI=1S/C8H14N2OS/c1-7(6-12-2)5-10-8(11)3-4-9/h7H,3,5-6H2,1-2H3,(H,10,11) |
| InChIKey | UMFGFYHSDRZNFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |