C9H15N3O2S — CID 63959995
N-(cyanomethyl)-N'-(2-methyl-3-methylsulfanylpropyl)oxamide (PubChem CID 63959995) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(2-methyl-3-methylsulfanylpropyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(2-methyl-3-methylsulfanylpropyl)oxamide |
|---|---|
| PubChem CID | 63959995 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(cyanomethyl)-N'-(2-methyl-3-methylsulfanylpropyl)oxamide |
| SMILES | CSCC(C)CNC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C9H15N3O2S/c1-7(6-15-2)5-12-9(14)8(13)11-4-3-10/h7H,4-6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | FIFGCHCNQAGZFS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|