C8H15NO3S — CID 112617288
methyl 2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetate (PubChem CID 112617288) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is methyl 2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112617288 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | methyl 2-[(2-methyl-3-methylsulfanylpropyl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCC(C)CSC |
| InChI | InChI=1S/C8H15NO3S/c1-6(5-13-3)4-9-7(10)8(11)12-2/h6H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | UEOOHEYHPIUFFL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|