C9H18N2O2 — CID 63765601
propan-2-yl N-(2-amino-2-cyclopropylethyl)carbamate (PubChem CID 63765601) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is propan-2-yl N-(2-amino-2-cyclopropylethyl)carbamate.
| Compound Name | propan-2-yl N-(2-amino-2-cyclopropylethyl)carbamate |
|---|---|
| PubChem CID | 63765601 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | propan-2-yl N-(2-amino-2-cyclopropylethyl)carbamate |
| SMILES | CC(C)OC(=O)NCC(N)C1CC1 |
| InChI | InChI=1S/C9H18N2O2/c1-6(2)13-9(12)11-5-8(10)7-3-4-7/h6-8H,3-5,10H2,1-2H3,(H,11,12) |
| InChIKey | NVJGLQVKXFQARL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |