C17H36N2O3 — CID 162127345
3-methyl-N-(2-methylpropyl)butanamide;propan-2-yl N-(2-methylpropyl)carbamate (PubChem CID 162127345) has the molecular formula C17H36N2O3 and a molecular weight of 316.49 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpropyl)butanamide;propan-2-yl N-(2-methylpropyl)carbamate.
| Compound Name | 3-methyl-N-(2-methylpropyl)butanamide;propan-2-yl N-(2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 162127345 |
| Molecular Formula | C17H36N2O3 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | 3-methyl-N-(2-methylpropyl)butanamide;propan-2-yl N-(2-methylpropyl)carbamate |
| SMILES | CC(C)CNC(=O)CC(C)C.CC(C)CNC(=O)OC(C)C |
| InChI | InChI=1S/C9H19NO.C8H17NO2/c1-7(2)5-9(11)10-6-8(3)4;1-6(2)5-9-8(10)11-7(3)4/h7-8H,5-6H2,1-4H3,(H,10,11);6-7H,5H2,1-4H3,(H,9,10) |
| InChIKey | ZIFBTQGLQQDXOT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |