C9H19NO3 — CID 66106917
propan-2-yl N-(4-hydroxy-2-methylbutyl)carbamate (PubChem CID 66106917) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is propan-2-yl N-(4-hydroxy-2-methylbutyl)carbamate.
| Compound Name | propan-2-yl N-(4-hydroxy-2-methylbutyl)carbamate |
|---|---|
| PubChem CID | 66106917 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | propan-2-yl N-(4-hydroxy-2-methylbutyl)carbamate |
| SMILES | CC(CCO)CNC(=O)OC(C)C |
| InChI | InChI=1S/C9H19NO3/c1-7(2)13-9(12)10-6-8(3)4-5-11/h7-8,11H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | WVKGUZLGYGPHSM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |