C7H15NO3 — CID 66107566
methyl N-(4-hydroxy-2-methylbutyl)carbamate (PubChem CID 66107566) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is methyl N-(4-hydroxy-2-methylbutyl)carbamate.
| Compound Name | methyl N-(4-hydroxy-2-methylbutyl)carbamate |
|---|---|
| PubChem CID | 66107566 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | methyl N-(4-hydroxy-2-methylbutyl)carbamate |
| SMILES | COC(=O)NCC(C)CCO |
| InChI | InChI=1S/C7H15NO3/c1-6(3-4-9)5-8-7(10)11-2/h6,9H,3-5H2,1-2H3,(H,8,10) |
| InChIKey | YDGSYAHFMHOUNW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |