C7H15NO3 — CID 115593989
methyl N-(3-methoxy-2-methylpropyl)carbamate (PubChem CID 115593989) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is methyl N-(3-methoxy-2-methylpropyl)carbamate.
| Compound Name | methyl N-(3-methoxy-2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 115593989 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | methyl N-(3-methoxy-2-methylpropyl)carbamate |
| SMILES | COCC(C)CNC(=O)OC |
| InChI | InChI=1S/C7H15NO3/c1-6(5-10-2)4-8-7(9)11-3/h6H,4-5H2,1-3H3,(H,8,9) |
| InChIKey | HHQCKYKSGDHVDY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |