C9H17NO4 — CID 114898277
3-[(3-methoxy-2-methylpropyl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 114898277) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-[(3-methoxy-2-methylpropyl)amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(3-methoxy-2-methylpropyl)amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114898277 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-[(3-methoxy-2-methylpropyl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | COCC(C)CNC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C9H17NO4/c1-6(5-14-3)4-10-8(11)7(2)9(12)13/h6-7H,4-5H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | FRMQWQCQTWMNHM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|