C19H29NO6 — CID 67171216
2-[(1S,5S,6S)-3-methyl-6-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 67171216) has the molecular formula C19H29NO6 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-[(1S,5S,6S)-3-methyl-6-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1S,5S,6S)-3-methyl-6-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 67171216 |
| Molecular Formula | C19H29NO6 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-[(1S,5S,6S)-3-methyl-6-[[[(1R)-2-methyl-1-propanoyloxypropoxy]carbonylamino]methyl]-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC(=O)O[C@H](OC(=O)NC[C@]1(CC(=O)O)C[C@@H]2CC(C)=C[C@H]21)C(C)C |
| InChI | InChI=1S/C19H29NO6/c1-5-16(23)25-17(11(2)3)26-18(24)20-10-19(9-15(21)22)8-13-6-12(4)7-14(13)19/h7,11,13-14,17H,5-6,8-10H2,1-4H3,(H,20,24)(H,21,22)/t13-,14+,17+,19+/m0/s1 |
| InChIKey | URDFTVGNQAWUIA-FCZZECIWSA-N |
| XLogP | 3.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|