C18H24ClNO7 — CID 67172426
(2S)-2-(2-chlorophenoxy)-3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propanoic acid (PubChem CID 67172426) has the molecular formula C18H24ClNO7 and a molecular weight of 401.84 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenoxy)-3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propanoic acid.
| Compound Name | (2S)-2-(2-chlorophenoxy)-3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 67172426 |
| Molecular Formula | C18H24ClNO7 |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (2S)-2-(2-chlorophenoxy)-3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propanoic acid |
| SMILES | CC(C)C(=O)O[C@@H](OC(=O)NC[C@H](Oc1ccccc1Cl)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H24ClNO7/c1-10(2)16(23)26-17(11(3)4)27-18(24)20-9-14(15(21)22)25-13-8-6-5-7-12(13)19/h5-8,10-11,14,17H,9H2,1-4H3,(H,20,24)(H,21,22)/t14-,17-/m0/s1 |
| InChIKey | IRFZCIJIJKSJAN-YOEHRIQHSA-N |
| XLogP | 3.08 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|