C17H15ClNNaO7 — CID 66753505
sodium 2-(4-chlorophenyl)-4-(furan-2-carbonyloxymethoxycarbonylamino)butanoate (PubChem CID 66753505) has the molecular formula C17H15ClNNaO7 and a molecular weight of 403.75 g/mol. Its IUPAC name is sodium 2-(4-chlorophenyl)-4-(furan-2-carbonyloxymethoxycarbonylamino)butanoate.
| Compound Name | sodium 2-(4-chlorophenyl)-4-(furan-2-carbonyloxymethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 66753505 |
| Molecular Formula | C17H15ClNNaO7 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | sodium 2-(4-chlorophenyl)-4-(furan-2-carbonyloxymethoxycarbonylamino)butanoate |
| SMILES | O=C(NCCC(C(=O)[O-])c1ccc(Cl)cc1)OCOC(=O)c1ccco1.[Na+] |
| InChI | InChI=1S/C17H16ClNO7.Na/c18-12-5-3-11(4-6-12)13(15(20)21)7-8-19-17(23)26-10-25-16(22)14-2-1-9-24-14;/h1-6,9,13H,7-8,10H2,(H,19,23)(H,20,21);/q;+1/p-1 |
| InChIKey | ZXFRAZTVGLJMNG-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|