C22H29ClNNaO6 — CID 66753563
sodium 2-(4-chlorophenyl)-4-[1-(cyclohexanecarbonyloxy)butoxycarbonylamino]butanoate (PubChem CID 66753563) has the molecular formula C22H29ClNNaO6 and a molecular weight of 461.92 g/mol. Its IUPAC name is sodium 2-(4-chlorophenyl)-4-[1-(cyclohexanecarbonyloxy)butoxycarbonylamino]butanoate.
| Compound Name | sodium 2-(4-chlorophenyl)-4-[1-(cyclohexanecarbonyloxy)butoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 66753563 |
| Molecular Formula | C22H29ClNNaO6 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | sodium 2-(4-chlorophenyl)-4-[1-(cyclohexanecarbonyloxy)butoxycarbonylamino]butanoate |
| SMILES | CCCC(OC(=O)NCCC(C(=O)[O-])c1ccc(Cl)cc1)OC(=O)C1CCCCC1.[Na+] |
| InChI | InChI=1S/C22H30ClNO6.Na/c1-2-6-19(29-21(27)16-7-4-3-5-8-16)30-22(28)24-14-13-18(20(25)26)15-9-11-17(23)12-10-15;/h9-12,16,18-19H,2-8,13-14H2,1H3,(H,24,28)(H,25,26);/q;+1/p-1 |
| InChIKey | DTCHMUNQMDWJTR-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|