C19H25ClNNaO8 — CID 66753701
sodium 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoate (PubChem CID 66753701) has the molecular formula C19H25ClNNaO8 and a molecular weight of 453.85 g/mol. Its IUPAC name is sodium 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoate.
| Compound Name | sodium 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 66753701 |
| Molecular Formula | C19H25ClNNaO8 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | sodium 2-(4-chlorophenyl)-4-(2,2-diethoxypropanoyloxymethoxycarbonylamino)butanoate |
| SMILES | CCOC(C)(OCC)C(=O)OCOC(=O)NCCC(C(=O)[O-])c1ccc(Cl)cc1.[Na+] |
| InChI | InChI=1S/C19H26ClNO8.Na/c1-4-28-19(3,29-5-2)17(24)26-12-27-18(25)21-11-10-15(16(22)23)13-6-8-14(20)9-7-13;/h6-9,15H,4-5,10-12H2,1-3H3,(H,21,25)(H,22,23);/q;+1/p-1 |
| InChIKey | GKZSNNWTUADHLG-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|