C16H21ClNNaO4 — CID 69223000
sodium 2-(4-chlorophenyl)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate (PubChem CID 69223000) has the molecular formula C16H21ClNNaO4 and a molecular weight of 349.79 g/mol. Its IUPAC name is sodium 2-(4-chlorophenyl)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate.
| Compound Name | sodium 2-(4-chlorophenyl)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 69223000 |
| Molecular Formula | C16H21ClNNaO4 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | sodium 2-(4-chlorophenyl)-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
| SMILES | CN(CCC(C(=O)[O-])c1ccc(Cl)cc1)C(=O)OC(C)(C)C.[Na+] |
| InChI | InChI=1S/C16H22ClNO4.Na/c1-16(2,3)22-15(21)18(4)10-9-13(14(19)20)11-5-7-12(17)8-6-11;/h5-8,13H,9-10H2,1-4H3,(H,19,20);/q;+1/p-1 |
| InChIKey | BPLZBSHSFLYNSV-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |