C20H24ClNO6S — CID 87401513
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 87401513) has the molecular formula C20H24ClNO6S and a molecular weight of 441.93 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 87401513 |
| Molecular Formula | C20H24ClNO6S |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CN(CC(O)c1ccc(OS(=O)(=O)c2ccc(Cl)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24ClNO6S/c1-20(2,3)27-19(24)22(4)13-18(23)14-5-9-16(10-6-14)28-29(25,26)17-11-7-15(21)8-12-17/h5-12,18,23H,13H2,1-4H3 |
| InChIKey | CXRMVVJNVFLFLR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|