C24H27NO6S — CID 87402091
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-2-sulfonate (PubChem CID 87402091) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 87402091 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] naphthalene-2-sulfonate |
| SMILES | CN(CC(O)c1ccc(OS(=O)(=O)c2ccc3ccccc3c2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H27NO6S/c1-24(2,3)30-23(27)25(4)16-22(26)18-9-12-20(13-10-18)31-32(28,29)21-14-11-17-7-5-6-8-19(17)15-21/h5-15,22,26H,16H2,1-4H3 |
| InChIKey | NNGXEHBYESPZPJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|