C23H29NO5 — CID 67438948
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2-phenylpropanoate (PubChem CID 67438948) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2-phenylpropanoate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2-phenylpropanoate |
|---|---|
| PubChem CID | 67438948 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2-phenylpropanoate |
| SMILES | CC(C(=O)Oc1ccc(C(O)CN(C)C(=O)OC(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO5/c1-16(17-9-7-6-8-10-17)21(26)28-19-13-11-18(12-14-19)20(25)15-24(5)22(27)29-23(2,3)4/h6-14,16,20,25H,15H2,1-5H3 |
| InChIKey | PMXNLDXKKINAKW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|