C23H29NO7 — CID 67440875
[4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2,4-dimethoxybenzoate (PubChem CID 67440875) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2,4-dimethoxybenzoate.
| Compound Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 67440875 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [4-[1-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(O)CN(C)C(=O)OC(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H29NO7/c1-23(2,3)31-22(27)24(4)14-19(25)15-7-9-16(10-8-15)30-21(26)18-12-11-17(28-5)13-20(18)29-6/h7-13,19,25H,14H2,1-6H3 |
| InChIKey | BRJSSPUSKPACDK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|