C27H31N3O8 — CID 67440596
1-[4-(2,4-dimethoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate (PubChem CID 67440596) has the molecular formula C27H31N3O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate.
| Compound Name | 1-[4-(2,4-dimethoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67440596 |
| Molecular Formula | C27H31N3O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 1-[4-(2,4-dimethoxybenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc([N+]3(C(=O)[O-])C=CN=C3CCN(C)C(=O)OC(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H31N3O8/c1-27(2,3)38-25(32)29(4)15-13-23-28-14-16-30(23,26(33)34)18-7-9-19(10-8-18)37-24(31)21-12-11-20(35-5)17-22(21)36-6/h7-12,14,16-17H,13,15H2,1-6H3 |
| InChIKey | XYGBMFHKECLNMB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|