C25H25N5O10 — CID 87401277
1-[4-(3,5-dinitrobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate (PubChem CID 87401277) has the molecular formula C25H25N5O10 and a molecular weight of 555.50 g/mol. Its IUPAC name is 1-[4-(3,5-dinitrobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate.
| Compound Name | 1-[4-(3,5-dinitrobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87401277 |
| Molecular Formula | C25H25N5O10 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 1-[4-(3,5-dinitrobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
| SMILES | CN(CCC1=NC=C[N+]1(C(=O)[O-])c1ccc(OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H25N5O10/c1-25(2,3)40-23(32)27(4)11-9-21-26-10-12-30(21,24(33)34)19-5-7-20(8-6-19)39-22(31)16-13-17(28(35)36)15-18(14-16)29(37)38/h5-8,10,12-15H,9,11H2,1-4H3 |
| InChIKey | ZTDOZLYCYQLTTR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 194.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|