C25H26ClN3O6 — CID 67441661
1-[4-(4-chlorobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate (PubChem CID 67441661) has the molecular formula C25H26ClN3O6 and a molecular weight of 499.95 g/mol. Its IUPAC name is 1-[4-(4-chlorobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate.
| Compound Name | 1-[4-(4-chlorobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 67441661 |
| Molecular Formula | C25H26ClN3O6 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 1-[4-(4-chlorobenzoyl)oxyphenyl]-2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]imidazol-1-ium-1-carboxylate |
| SMILES | CN(CCC1=NC=C[N+]1(C(=O)[O-])c1ccc(OC(=O)c2ccc(Cl)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H26ClN3O6/c1-25(2,3)35-23(31)28(4)15-13-21-27-14-16-29(21,24(32)33)19-9-11-20(12-10-19)34-22(30)17-5-7-18(26)8-6-17/h5-12,14,16H,13,15H2,1-4H3 |
| InChIKey | HPIITHKREFZOQW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|