C33H44N3O6+ — CID 67439938
2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(4-octylbenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylic acid (PubChem CID 67439938) has the molecular formula C33H44N3O6+ and a molecular weight of 578.73 g/mol. Its IUPAC name is 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(4-octylbenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylic acid.
| Compound Name | 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(4-octylbenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 67439938 |
| Molecular Formula | C33H44N3O6+ |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | 2-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-1-[4-(4-octylbenzoyl)oxyphenyl]imidazol-1-ium-1-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)Oc2ccc([N+]3(C(=O)O)C=CN=C3CCN(C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H43N3O6/c1-6-7-8-9-10-11-12-25-13-15-26(16-14-25)30(37)41-28-19-17-27(18-20-28)36(32(39)40)24-22-34-29(36)21-23-35(5)31(38)42-33(2,3)4/h13-20,22,24H,6-12,21,23H2,1-5H3/p+1 |
| InChIKey | VPHGCMQUNMMCOV-UHFFFAOYSA-O |
| XLogP | 7.93 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|